Products 97143-65-2
CAS 97143-65-2 appears in our catalog under these names: Doxylamine Impurity 5, Doxylamine Aliphatic N-Oxide, Doxylamine Impurity 7, Doxylamine N-Oxide, >95% (HPLC), Doxylamine N-oxide. Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth, Sigma-Aldrich. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
N,N-dimethyl-2-(1-phenyl-1-pyridin-2-ylethoxy)ethanamine oxide (CAS 97143-65-2) is a chemical compound with the molecular formula C17H22N2O2 and a molecular weight of 286.37 g/mol. IUPAC name: N,N-dimethyl-2-(1-phenyl-1-pyridin-2-ylethoxy)ethanamine oxide. InChIKey: SSGKPGKMFJONCR-UHFFFAOYSA-N.
| Molecular formula | C17H22N2O2 |
|---|---|
| Molecular weight | 286.37 g/mol |
| IUPAC name | N,N-dimethyl-2-(1-phenyl-1-pyridin-2-ylethoxy)ethanamine oxide |
| InChIKey | SSGKPGKMFJONCR-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=CC=C1)(C2=CC=CC=N2)OCC[N+](C)(C)[O-] |
Computed by PubChem (NCBI)