CAS 97269-22-2 is the registry number for N-Boc-N-methyl-3-cyclohexanyl-L-alanine, 98+%. Offered by: AmBeed. Available pack sizes: 5g.
(2S)-3-cyclohexyl-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoic acid (CAS 97269-22-2) is a chemical compound with the molecular formula C15H27NO4 and a molecular weight of 285.38 g/mol. IUPAC name: (2S)-3-cyclohexyl-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoic acid. InChIKey: AFDTWSLGUIJFTE-LBPRGKRZSA-N.
| Molecular formula | C15H27NO4 |
|---|---|
| Molecular weight | 285.38 g/mol |
| IUPAC name | (2S)-3-cyclohexyl-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoic acid |
| InChIKey | AFDTWSLGUIJFTE-LBPRGKRZSA-N |
| SMILES | CC(C)(C)OC(=O)N(C)[C@@H](CC1CCCCC1)C(=O)O |
Computed by PubChem (NCBI)