CAS 97337-32-1 appears in our catalog under these names: 4,6–Dichloro–7H–pyrrolo(2,3–d)pyrimidine, 4,6-dichloro-7H-pyrrolo[2,3-d]pyrimidine, 95%, 95%, 4,6-DICHLORO-7H-PYRROLO[2,3-D]PYRIMIDINE, 95%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
4,6-dichloro-7H-pyrrolo[2,3-d]pyrimidine (CAS 97337-32-1) is a chemical compound with the molecular formula C6H3Cl2N3 and a molecular weight of 188.01 g/mol. IUPAC name: 4,6-dichloro-7H-pyrrolo[2,3-d]pyrimidine. InChIKey: CGTRULURZFVPIX-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2N3 |
|---|---|
| Molecular weight | 188.01 g/mol |
| IUPAC name | 4,6-dichloro-7H-pyrrolo[2,3-d]pyrimidine |
| InChIKey | CGTRULURZFVPIX-UHFFFAOYSA-N |
| SMILES | C1=C(NC2=C1C(=NC=N2)Cl)Cl |
Computed by PubChem (NCBI)