Products 97339-52-1
CAS 97339-52-1 is the registry number for 2,2'-([1,1'-Biphenyl]-4,4'-diyl)bis(2-oxoacetaldehyde) hydrate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2-[4-(4-oxaldehydoylphenyl)phenyl]-2-oxoacetaldehyde;hydrate (CAS 97339-52-1) is a chemical compound with the molecular formula C16H12O5 and a molecular weight of 284.26 g/mol. IUPAC name: 2-[4-(4-oxaldehydoylphenyl)phenyl]-2-oxoacetaldehyde;hydrate. InChIKey: ISXCSNYYJXJBQD-UHFFFAOYSA-N.
| Molecular formula | C16H12O5 |
|---|---|
| Molecular weight | 284.26 g/mol |
| IUPAC name | 2-[4-(4-oxaldehydoylphenyl)phenyl]-2-oxoacetaldehyde;hydrate |
| InChIKey | ISXCSNYYJXJBQD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)C(=O)C=O)C(=O)C=O.O |
Computed by PubChem (NCBI)