Products 97465-71-9
CAS 97465-71-9 appears in our catalog under these names: Tanshindiol C, Tanshindiol C, 98.47%, Tanshindiol C, 98%. Offered by: GLPBio, MedChemExpress, Chemat. Available pack sizes: 1mg, 10 mg, 1 mg, 5 mg, 5mg.
(6R,7R)-6,7-dihydroxy-1,6-dimethyl-8,9-dihydro-7H-naphtho[1,2-g][1]benzofuran-10,11-dione (CAS 97465-71-9) is a chemical compound with the molecular formula C18H16O5 and a molecular weight of 312.3 g/mol. IUPAC name: (6R,7R)-6,7-dihydroxy-1,6-dimethyl-8,9-dihydro-7H-naphtho[1,2-g][1]benzofuran-10,11-dione. InChIKey: RTKDBIDPGKCZJS-KZULUSFZSA-N.
| Molecular formula | C18H16O5 |
|---|---|
| Molecular weight | 312.3 g/mol |
| IUPAC name | (6R,7R)-6,7-dihydroxy-1,6-dimethyl-8,9-dihydro-7H-naphtho[1,2-g][1]benzofuran-10,11-dione |
| InChIKey | RTKDBIDPGKCZJS-KZULUSFZSA-N |
| SMILES | CC1=COC2=C1C(=O)C(=O)C3=C2C=CC4=C3CC[C@H]([C@]4(C)O)O |
Computed by PubChem (NCBI)