CAS 54528-39-1 is the registry number for 3-(3,4-Dimethoxy-phenyl)-7-hydroxy-2-methyl-chromen-4-one, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 10g, 1g.
3-(3,4-dimethoxyphenyl)-7-hydroxy-2-methylchromen-4-one (CAS 54528-39-1) is a chemical compound with the molecular formula C18H16O5 and a molecular weight of 312.3 g/mol. IUPAC name: 3-(3,4-dimethoxyphenyl)-7-hydroxy-2-methylchromen-4-one. InChIKey: OUQFTNLPUKDFDZ-UHFFFAOYSA-N.
| Molecular formula | C18H16O5 |
|---|---|
| Molecular weight | 312.3 g/mol |
| IUPAC name | 3-(3,4-dimethoxyphenyl)-7-hydroxy-2-methylchromen-4-one |
| InChIKey | OUQFTNLPUKDFDZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)C2=C(O1)C=C(C=C2)O)C3=CC(=C(C=C3)OC)OC |
Computed by PubChem (NCBI)