CAS 1162-82-9 appears in our catalog under these names: Genistein trimethyl ether, 97%, 5,7,4'-Trimethoxyisoflavone, 5,7-Dimethoxy-3-(4-methoxyphenyl)-4H-1-benzopyran-4-one, 95%, 95%, 5,7-Dimethoxy-3-(4-methoxyphenyl)-4H-chromen-4-one, 97%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 10g, 5g, 250mg, 100mg, 500mg, 1000mg.
5,7-dimethoxy-3-(4-methoxyphenyl)chromen-4-one (CAS 1162-82-9) is a chemical compound with the molecular formula C18H16O5 and a molecular weight of 312.3 g/mol. IUPAC name: 5,7-dimethoxy-3-(4-methoxyphenyl)chromen-4-one. InChIKey: PVVORTURQPBPEQ-UHFFFAOYSA-N.
| Molecular formula | C18H16O5 |
|---|---|
| Molecular weight | 312.3 g/mol |
| IUPAC name | 5,7-dimethoxy-3-(4-methoxyphenyl)chromen-4-one |
| InChIKey | PVVORTURQPBPEQ-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=COC3=C(C2=O)C(=CC(=C3)OC)OC |
Computed by PubChem (NCBI)