CAS 97761-90-5 appears in our catalog under these names: 2,6–Dimethyl–3–O–methyl–4–isobutyrylphloroglucinol, 2,6-Dimethyl-3-o-methyl-4-isobutyrylphloroglucinol. Offered by: GLPBio, Biosynth. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg.
1-(2,4-dihydroxy-6-methoxy-3,5-dimethylphenyl)-2-methylpropan-1-one (CAS 97761-90-5) is a chemical compound with the molecular formula C13H18O4 and a molecular weight of 238.28 g/mol. IUPAC name: 1-(2,4-dihydroxy-6-methoxy-3,5-dimethylphenyl)-2-methylpropan-1-one. InChIKey: XSRVOTDOTHTRED-UHFFFAOYSA-N.
| Molecular formula | C13H18O4 |
|---|---|
| Molecular weight | 238.28 g/mol |
| IUPAC name | 1-(2,4-dihydroxy-6-methoxy-3,5-dimethylphenyl)-2-methylpropan-1-one |
| InChIKey | XSRVOTDOTHTRED-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=C1O)C(=O)C(C)C)OC)C)O |
Computed by PubChem (NCBI)