CAS 97846-18-9 is the registry number for Ipriflavone metabolites IV. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-(4-hydroxyphenyl)-7-propan-2-yloxychromen-4-one (CAS 97846-18-9) is a chemical compound with the molecular formula C18H16O4 and a molecular weight of 296.3 g/mol. IUPAC name: 3-(4-hydroxyphenyl)-7-propan-2-yloxychromen-4-one. InChIKey: DEQMUPGWSXUDKV-UHFFFAOYSA-N.
| Molecular formula | C18H16O4 |
|---|---|
| Molecular weight | 296.3 g/mol |
| IUPAC name | 3-(4-hydroxyphenyl)-7-propan-2-yloxychromen-4-one |
| InChIKey | DEQMUPGWSXUDKV-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=CC2=C(C=C1)C(=O)C(=CO2)C3=CC=C(C=C3)O |
Computed by PubChem (NCBI)