Products 97935-71-2
CAS 97935-71-2 is the registry number for 1-Benzyl-3-carboxypyridin-1-ium Bromide, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
1-benzylpyridin-1-ium-3-carboxylic acid bromide (CAS 97935-71-2) is a chemical compound with the molecular formula C13H12BrNO2 and a molecular weight of 294.14 g/mol. IUPAC name: 1-benzylpyridin-1-ium-3-carboxylic acid bromide. InChIKey: HLURLGXYNLRFAC-UHFFFAOYSA-N.
| Molecular formula | C13H12BrNO2 |
|---|---|
| Molecular weight | 294.14 g/mol |
| IUPAC name | 1-benzylpyridin-1-ium-3-carboxylic acid bromide |
| InChIKey | HLURLGXYNLRFAC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C[N+]2=CC=CC(=C2)C(=O)O.[Br-] |
Computed by PubChem (NCBI)