CAS 98167-06-7 appears in our catalog under these names: (R)-(+)-Indoline-2-carboxylic acid, 97%, (R)–Indoline–2–carboxylic acid, (R)-(+)-Indoline-2-carboxylic acid, 97% , (R)-Indoline-2-carboxylic Acid, 95%, 95%, (R)-Indoline-2-carboxylic acid, 95%. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 100g, 10g, 250mg, 100mg.
(2R)-2,3-dihydro-1H-indole-2-carboxylic acid (CAS 98167-06-7) is a chemical compound with the molecular formula C9H9NO2 and a molecular weight of 163.17 g/mol. IUPAC name: (2R)-2,3-dihydro-1H-indole-2-carboxylic acid. InChIKey: QNRXNRGSOJZINA-MRVPVSSYSA-N.
| Molecular formula | C9H9NO2 |
|---|---|
| Molecular weight | 163.17 g/mol |
| IUPAC name | (2R)-2,3-dihydro-1H-indole-2-carboxylic acid |
| InChIKey | QNRXNRGSOJZINA-MRVPVSSYSA-N |
| SMILES | C1[C@@H](NC2=CC=CC=C21)C(=O)O |
Computed by PubChem (NCBI)