cas: 98167-06-7 — see every product listed under this CAS number, including other names
(R)-Indoline-2-carboxylic Acid, 95%, 95% (CAS 98167-06-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114CBC-250mg |
| cas | 98167-06-7 |
| size | 250mg |
| availability | 150g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 141.20 Pln | |
| Chemat | 1g | 203.60 Pln | |
| Chemat | 5g | 462.80 Pln | |
| Chemat | 10g | 750.80 Pln | |
| Chemat | 25g | 1480.40 Pln | |
| Chemat | 100mg | 122.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(2R)-2,3-dihydro-1H-indole-2-carboxylic acid (CAS 98167-06-7) is a chemical compound with the molecular formula C9H9NO2 and a molecular weight of 163.17 g/mol. IUPAC name: (2R)-2,3-dihydro-1H-indole-2-carboxylic acid. InChIKey: QNRXNRGSOJZINA-MRVPVSSYSA-N.
| Molecular formula | C9H9NO2 |
|---|---|
| Molecular weight | 163.17 g/mol |
| IUPAC name | (2R)-2,3-dihydro-1H-indole-2-carboxylic acid |
| InChIKey | QNRXNRGSOJZINA-MRVPVSSYSA-N |
| SMILES | C1[C@@H](NC2=CC=CC=C21)C(=O)O |
Computed by PubChem (NCBI)