CAS 98191-99-2 appears in our catalog under these names: 2-(2-Chlorophenyl)-4,5-dihydro-4,4-dimethyloxazole, 95%, 2-(2-Chlorophenyl)-4,4-dimethyl-4,5-dihydrooxazole, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
2-(2-chlorophenyl)-4,4-dimethyl-5H-1,3-oxazole (CAS 98191-99-2) is a chemical compound with the molecular formula C11H12ClNO and a molecular weight of 209.67 g/mol. IUPAC name: 2-(2-chlorophenyl)-4,4-dimethyl-5H-1,3-oxazole. InChIKey: VOMZEVDJNHHMLC-UHFFFAOYSA-N.
| Molecular formula | C11H12ClNO |
|---|---|
| Molecular weight | 209.67 g/mol |
| IUPAC name | 2-(2-chlorophenyl)-4,4-dimethyl-5H-1,3-oxazole |
| InChIKey | VOMZEVDJNHHMLC-UHFFFAOYSA-N |
| SMILES | CC1(COC(=N1)C2=CC=CC=C2Cl)C |
Computed by PubChem (NCBI)