CAS 98276-88-1 is the registry number for 5,6-Dimethyl-3-nitro-1,2-dihydropyridin-2-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5,6-dimethyl-3-nitro-1H-pyridin-2-one (CAS 98276-88-1) is a chemical compound with the molecular formula C7H8N2O3 and a molecular weight of 168.15 g/mol. IUPAC name: 5,6-dimethyl-3-nitro-1H-pyridin-2-one. InChIKey: AAODRZMUIIDRJX-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O3 |
|---|---|
| Molecular weight | 168.15 g/mol |
| IUPAC name | 5,6-dimethyl-3-nitro-1H-pyridin-2-one |
| InChIKey | AAODRZMUIIDRJX-UHFFFAOYSA-N |
| SMILES | CC1=C(NC(=O)C(=C1)[N+](=O)[O-])C |
Computed by PubChem (NCBI)