CAS 98300-40-4 is the registry number for 1-(2,3-Dimethoxy-6-nitrophenyl)ethanone, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1-(2,3-dimethoxy-6-nitrophenyl)ethanone (CAS 98300-40-4) is a chemical compound with the molecular formula C10H11NO5 and a molecular weight of 225.20 g/mol. IUPAC name: 1-(2,3-dimethoxy-6-nitrophenyl)ethanone. InChIKey: JTYVOUDOGJPFSJ-UHFFFAOYSA-N.
| Molecular formula | C10H11NO5 |
|---|---|
| Molecular weight | 225.20 g/mol |
| IUPAC name | 1-(2,3-dimethoxy-6-nitrophenyl)ethanone |
| InChIKey | JTYVOUDOGJPFSJ-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=CC(=C1OC)OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)