CAS 98352-76-2 is the registry number for CbZ–Gly–Gly–Ser–OH. Offered by: GLPBio. Available pack sizes: 1g.
(2S)-3-hydroxy-2-[[2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]acetyl]amino]propanoic acid (CAS 98352-76-2) is a chemical compound with the molecular formula C15H19N3O7 and a molecular weight of 353.33 g/mol. IUPAC name: (2S)-3-hydroxy-2-[[2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]acetyl]amino]propanoic acid. InChIKey: KYTIRPLRFNXNAU-NSHDSACASA-N.
| Molecular formula | C15H19N3O7 |
|---|---|
| Molecular weight | 353.33 g/mol |
| IUPAC name | (2S)-3-hydroxy-2-[[2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]acetyl]amino]propanoic acid |
| InChIKey | KYTIRPLRFNXNAU-NSHDSACASA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NCC(=O)NCC(=O)N[C@@H](CO)C(=O)O |
Computed by PubChem (NCBI)