CAS 98488-59-6 is the registry number for 2-((1-Methyl-4-nitro-1H-pyrrol-2-yl)formamido)acetic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-[(1-methyl-4-nitropyrrole-2-carbonyl)amino]acetic acid (CAS 98488-59-6) is a chemical compound with the molecular formula C8H9N3O5 and a molecular weight of 227.17 g/mol. IUPAC name: 2-[(1-methyl-4-nitropyrrole-2-carbonyl)amino]acetic acid. InChIKey: QDACBBDMVZBXBY-UHFFFAOYSA-N.
| Molecular formula | C8H9N3O5 |
|---|---|
| Molecular weight | 227.17 g/mol |
| IUPAC name | 2-[(1-methyl-4-nitropyrrole-2-carbonyl)amino]acetic acid |
| InChIKey | QDACBBDMVZBXBY-UHFFFAOYSA-N |
| SMILES | CN1C=C(C=C1C(=O)NCC(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)