CAS 98545-65-4 appears in our catalog under these names: 4–Bromo–3–nitro–5–methoxytoluene, 4-Bromo-3-nitro-5-methoxytoluene, 95%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 1g, 250mg.
2-bromo-1-methoxy-5-methyl-3-nitrobenzene (CAS 98545-65-4) is a chemical compound with the molecular formula C8H8BrNO3 and a molecular weight of 246.06 g/mol. IUPAC name: 2-bromo-1-methoxy-5-methyl-3-nitrobenzene. InChIKey: NWEUWEZZJALKPB-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO3 |
|---|---|
| Molecular weight | 246.06 g/mol |
| IUPAC name | 2-bromo-1-methoxy-5-methyl-3-nitrobenzene |
| InChIKey | NWEUWEZZJALKPB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)OC)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)