Products 98982-99-1
CAS 98982-99-1 is the registry number for Mepyramine N-Oxide. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 25mg.
2-[(4-methoxyphenyl)methyl-pyridin-2-ylamino]-N,N-dimethylethanamine oxide (CAS 98982-99-1) is a chemical compound with the molecular formula C17H23N3O2 and a molecular weight of 301.4 g/mol. IUPAC name: 2-[(4-methoxyphenyl)methyl-pyridin-2-ylamino]-N,N-dimethylethanamine oxide. InChIKey: IQDUZGGMNVZTAI-UHFFFAOYSA-N.
| Molecular formula | C17H23N3O2 |
|---|---|
| Molecular weight | 301.4 g/mol |
| IUPAC name | 2-[(4-methoxyphenyl)methyl-pyridin-2-ylamino]-N,N-dimethylethanamine oxide |
| InChIKey | IQDUZGGMNVZTAI-UHFFFAOYSA-N |
| SMILES | C[N+](C)(CCN(CC1=CC=C(C=C1)OC)C2=CC=CC=N2)[O-] |
Computed by PubChem (NCBI)