Products 99140-25-7
CAS 99140-25-7 is the registry number for Topoisomerase II inhibitor 3. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[3-(dimethylamino)propylamino]-7-hydroxy-4-nitro-10H-acridin-9-one (CAS 99140-25-7) is a chemical compound with the molecular formula C18H20N4O4 and a molecular weight of 356.4 g/mol. IUPAC name: 1-[3-(dimethylamino)propylamino]-7-hydroxy-4-nitro-10H-acridin-9-one. InChIKey: VNSZLRBNUNIGRI-UHFFFAOYSA-N.
| Molecular formula | C18H20N4O4 |
|---|---|
| Molecular weight | 356.4 g/mol |
| IUPAC name | 1-[3-(dimethylamino)propylamino]-7-hydroxy-4-nitro-10H-acridin-9-one |
| InChIKey | VNSZLRBNUNIGRI-UHFFFAOYSA-N |
| SMILES | CN(C)CCCNC1=C2C(=C(C=C1)[N+](=O)[O-])NC3=C(C2=O)C=C(C=C3)O |
Computed by PubChem (NCBI)
Synonyms:
Topoisomerase II inhibitor 3, orb1688755