Products 99216-79-2

CAS 99216-79-2 is the registry number for 1-[(4-Methylphenyl)amino]cyclohexanecarboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.

Structural formula: {0} (CAS {1})

1-(4-methylanilino)cyclohexane-1-carboxylic acid (CAS 99216-79-2) is a chemical compound with the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. IUPAC name: 1-(4-methylanilino)cyclohexane-1-carboxylic acid. InChIKey: WNPOXUUMAKKPEQ-UHFFFAOYSA-N.

Identity
Molecular formulaC14H19NO2
Molecular weight233.31 g/mol
IUPAC name1-(4-methylanilino)cyclohexane-1-carboxylic acid
InChIKeyWNPOXUUMAKKPEQ-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)NC2(CCCCC2)C(=O)O

Computed by PubChem (NCBI)