CAS 99226-02-5 appears in our catalog under these names: trans–2–(2–Methoxyphenyl)–5–oxotetrahydrofuran–3–carboxylic acid, trans-2-(2-Methoxyphenyl)-5-oxotetrahydrofuran-3-carboxylic acid, 97%, 97%, trans-2-(2-Methoxyphenyl)-5-oxotetrahydrofuran-3-carboxylic acid, 98%, trans-2-(2-Methoxyphenyl)-5-oxotetrahydrofuran-3-carboxylic acid, 97%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 10g, 5g, 1g, 25g, 100g, 250mg.
(2S,3S)-2-(2-methoxyphenyl)-5-oxooxolane-3-carboxylic acid (CAS 99226-02-5) is a chemical compound with the molecular formula C12H12O5 and a molecular weight of 236.22 g/mol. IUPAC name: (2S,3S)-2-(2-methoxyphenyl)-5-oxooxolane-3-carboxylic acid. InChIKey: LMMNYYZCVYAOOF-GZMMTYOYSA-N.
| Molecular formula | C12H12O5 |
|---|---|
| Molecular weight | 236.22 g/mol |
| IUPAC name | (2S,3S)-2-(2-methoxyphenyl)-5-oxooxolane-3-carboxylic acid |
| InChIKey | LMMNYYZCVYAOOF-GZMMTYOYSA-N |
| SMILES | COC1=CC=CC=C1[C@@H]2[C@H](CC(=O)O2)C(=O)O |
Computed by PubChem (NCBI)