Products 99508-25-5
CAS 99508-25-5 is the registry number for Carboxyamidotriazole Impurity 1. Offered by: Chemat Brand. Available pack sizes: on request.
(4-chlorophenyl)-[2,6-dichloro-4-(hydroxymethyl)phenyl]methanone (CAS 99508-25-5) is a chemical compound with the molecular formula C14H9Cl3O2 and a molecular weight of 315.6 g/mol. IUPAC name: (4-chlorophenyl)-[2,6-dichloro-4-(hydroxymethyl)phenyl]methanone. InChIKey: MHYSTUJBOQTTDW-UHFFFAOYSA-N.
| Molecular formula | C14H9Cl3O2 |
|---|---|
| Molecular weight | 315.6 g/mol |
| IUPAC name | (4-chlorophenyl)-[2,6-dichloro-4-(hydroxymethyl)phenyl]methanone |
| InChIKey | MHYSTUJBOQTTDW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C2=C(C=C(C=C2Cl)CO)Cl)Cl |
Computed by PubChem (NCBI)