CAS 99584-30-2 is the registry number for 1-Phenyl-1H-1,2,3-triazol-5-amine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-phenyltriazol-4-amine (CAS 99584-30-2) is a chemical compound with the molecular formula C8H8N4 and a molecular weight of 160.18 g/mol. IUPAC name: 3-phenyltriazol-4-amine. InChIKey: YDXSWXCCLCCENV-UHFFFAOYSA-N.
| Molecular formula | C8H8N4 |
|---|---|
| Molecular weight | 160.18 g/mol |
| IUPAC name | 3-phenyltriazol-4-amine |
| InChIKey | YDXSWXCCLCCENV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=CN=N2)N |
Computed by PubChem (NCBI)