Products 99689-20-0
CAS 99689-20-0 is the registry number for N-Acetylmuramic acid methyl ester. Offered by: Biosynth, MedChemExpress. Available pack sizes: 250mg, 100mg, 500mg, Get quote.
Methyl (2R)-2-[(2R,3S,4R,5S)-3-acetamido-2,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl]oxypropanoate (CAS 99689-20-0) is a chemical compound with the molecular formula C12H21NO8 and a molecular weight of 307.30 g/mol. IUPAC name: methyl (2R)-2-[(2R,3S,4R,5S)-3-acetamido-2,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl]oxypropanoate. InChIKey: QQQLKKYLIRADTB-FTUOSHNKSA-N.
| Molecular formula | C12H21NO8 |
|---|---|
| Molecular weight | 307.30 g/mol |
| IUPAC name | methyl (2R)-2-[(2R,3S,4R,5S)-3-acetamido-2,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl]oxypropanoate |
| InChIKey | QQQLKKYLIRADTB-FTUOSHNKSA-N |
| SMILES | C[C@H](C(=O)OC)O[C@@H]1[C@@H]([C@@H](OC([C@H]1O)CO)O)NC(=O)C |
Computed by PubChem (NCBI)