CAS 1227911-35-4 appears in our catalog under these names: 3-Piperidinecarboxylic acid, 6-Methyl-, Methyl ester, (3S,6R)-, (2R,3R)-2,3-dihydroxybutanedioate (1, 98%, 98%, Methyl (3S,6R)-6-methyl-3-piperidinecarboxylate (L-tartaric acid salt), 97.0%, Methyl (3S,6R)-6-methylpiperidine-3-carboxylate (2R,3R)-2,3-dihydroxysuccinate, 97%, (3S,6R)-Methyl 6-methylpiperidine-3-carboxylate (2R,3R)-2,3-dihydroxysuccinate, 98%. Offered by: Chemat, MedChemExpress, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, Get quote.
(2R,3R)-2,3-dihydroxybutanedioic acid;methyl (3S,6R)-6-methylpiperidine-3-carboxylate (CAS 1227911-35-4) is a chemical compound with the molecular formula C12H21NO8 and a molecular weight of 307.30 g/mol. IUPAC name: (2R,3R)-2,3-dihydroxybutanedioic acid;methyl (3S,6R)-6-methylpiperidine-3-carboxylate. InChIKey: YLXOMGUERJJTAW-SIDHLQFJSA-N.
| Molecular formula | C12H21NO8 |
|---|---|
| Molecular weight | 307.30 g/mol |
| IUPAC name | (2R,3R)-2,3-dihydroxybutanedioic acid;methyl (3S,6R)-6-methylpiperidine-3-carboxylate |
| InChIKey | YLXOMGUERJJTAW-SIDHLQFJSA-N |
| SMILES | C[C@@H]1CC[C@@H](CN1)C(=O)OC.[C@@H]([C@H](C(=O)O)O)(C(=O)O)O |
Computed by PubChem (NCBI)