CAS 60218-49-7 is the registry number for Ethyl (R)-nipecotate L-tartrate, 97%. Offered by: Combi-blocks. Available pack sizes: 25g, 500g, 5g, 1g, 100g.
(2R,3R)-2,3-dihydroxybutanedioic acid;ethyl (3R)-piperidine-3-carboxylate (CAS 60218-49-7) is a chemical compound with the molecular formula C12H21NO8 and a molecular weight of 307.30 g/mol. IUPAC name: (2R,3R)-2,3-dihydroxybutanedioic acid;ethyl (3R)-piperidine-3-carboxylate. InChIKey: HHPGQKZOPPDLNH-NWAAXCJESA-N.
| Molecular formula | C12H21NO8 |
|---|---|
| Molecular weight | 307.30 g/mol |
| IUPAC name | (2R,3R)-2,3-dihydroxybutanedioic acid;ethyl (3R)-piperidine-3-carboxylate |
| InChIKey | HHPGQKZOPPDLNH-NWAAXCJESA-N |
| SMILES | CCOC(=O)[C@@H]1CCCNC1.[C@@H]([C@H](C(=O)O)O)(C(=O)O)O |
Computed by PubChem (NCBI)