Products 2271281-02-6
CAS 2271281-02-6 is the registry number for 1-O-Glucosyl-pipecolic Acid (Mixture of Diastereomers). Offered by: TRC. Available pack sizes: 10mg.
1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypiperidine-2-carboxylic acid (CAS 2271281-02-6) is a chemical compound with the molecular formula C12H21NO8 and a molecular weight of 307.30 g/mol. IUPAC name: 1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypiperidine-2-carboxylic acid. InChIKey: QYTFIADBMINHQO-GNYDOHAMSA-N.
| Molecular formula | C12H21NO8 |
|---|---|
| Molecular weight | 307.30 g/mol |
| IUPAC name | 1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypiperidine-2-carboxylic acid |
| InChIKey | QYTFIADBMINHQO-GNYDOHAMSA-N |
| SMILES | C1CCN(C(C1)C(=O)O)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O |
Computed by PubChem (NCBI)