CAS 99896-39-6 is the registry number for 9,10-Dihydrophenanthrene-2,7-diol, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
9,10-dihydrophenanthrene-2,7-diol (CAS 99896-39-6) is a chemical compound with the molecular formula C14H12O2 and a molecular weight of 212.24 g/mol. IUPAC name: 9,10-dihydrophenanthrene-2,7-diol. InChIKey: QYFMFFVACPTERQ-UHFFFAOYSA-N.
| Molecular formula | C14H12O2 |
|---|---|
| Molecular weight | 212.24 g/mol |
| IUPAC name | 9,10-dihydrophenanthrene-2,7-diol |
| InChIKey | QYFMFFVACPTERQ-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC(=C2)O)C3=C1C=C(C=C3)O |
Computed by PubChem (NCBI)