Products 99985-57-6

CAS 99985-57-6 is the registry number for Orciprenaline sulfate Impurity 4. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

1-(4-hydroxyphenyl)-2-(propan-2-ylamino)ethanone (CAS 99985-57-6) is a chemical compound with the molecular formula C11H15NO2 and a molecular weight of 193.24 g/mol. IUPAC name: 1-(4-hydroxyphenyl)-2-(propan-2-ylamino)ethanone. InChIKey: YZMBSDNWDWFLSG-UHFFFAOYSA-N.

Identity
Molecular formulaC11H15NO2
Molecular weight193.24 g/mol
IUPAC name1-(4-hydroxyphenyl)-2-(propan-2-ylamino)ethanone
InChIKeyYZMBSDNWDWFLSG-UHFFFAOYSA-N
SMILESCC(C)NCC(=O)C1=CC=C(C=C1)O

Computed by PubChem (NCBI)