cas: 118768-13-1 — see every product listed under this CAS number, including other names
pyrrolo[1,2-b]pyridazine-6-carboxylic acid, 95%, 95% (CAS 118768-13-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114A5Q-100mg |
| cas | 118768-13-1 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 314.00 Pln | |
| Chemat | 1g | 1634.00 Pln | |
| Chemat | 250mg | 621.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Pyrrolo[1,2-b]pyridazine-6-carboxylic acid (CAS 118768-13-1) is a chemical compound with the molecular formula C8H6N2O2 and a molecular weight of 162.15 g/mol. IUPAC name: pyrrolo[1,2-b]pyridazine-6-carboxylic acid. InChIKey: SLVBZCDHIKVNNN-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O2 |
|---|---|
| Molecular weight | 162.15 g/mol |
| IUPAC name | pyrrolo[1,2-b]pyridazine-6-carboxylic acid |
| InChIKey | SLVBZCDHIKVNNN-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=CN2N=C1)C(=O)O |
Computed by PubChem (NCBI)