cas: 2102410-18-2 — see every product listed under this CAS number, including other names
rel-tert-Butyl ((3R,4R)-4-methylpyrrolidin-3-yl)carbamate hydrochloride, 95%, 95% (CAS 2102410-18-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FPJF-100mg |
| cas | 2102410-18-2 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 280.40 Pln | |
| Chemat | 250mg | 472.40 Pln | |
| Chemat | 1g | 1250.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-[(3S,4S)-4-methylpyrrolidin-3-yl]carbamate;hydrochloride (CAS 2102410-18-2) is a chemical compound with the molecular formula C10H21ClN2O2 and a molecular weight of 236.74 g/mol. IUPAC name: tert-butyl N-[(3S,4S)-4-methylpyrrolidin-3-yl]carbamate;hydrochloride. InChIKey: RZXBZGWTVRXEHJ-KZYPOYLOSA-N.
| Molecular formula | C10H21ClN2O2 |
|---|---|
| Molecular weight | 236.74 g/mol |
| IUPAC name | tert-butyl N-[(3S,4S)-4-methylpyrrolidin-3-yl]carbamate;hydrochloride |
| InChIKey | RZXBZGWTVRXEHJ-KZYPOYLOSA-N |
| SMILES | C[C@H]1CNC[C@H]1NC(=O)OC(C)(C)C.Cl |
Computed by PubChem (NCBI)