CAS 2173637-27-7 appears in our catalog under these names: tert-Butyl (3r,4s)-4-methylpyrrolidin-3-ylcarbamate hydrochloride, 95%, tert–Butyl (3R,4S)–4–methylpyrrolidin–3–ylcarbamate hydrochloride, tert-Butyl (3R,4S)-4-methylpyrrolidin-3-ylcarbamate hydrochloride 97%, tert-Butyl (3R,4S)-4-methylpyrrolidin-3-ylcarbamate hydrochloride, 97%, 97%, TERT-BUTYL (3R,4S)-4-METHYLPYRROLIDIN-3-YLCARBAMATE HYDROCHLORIDE, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 50mg.
Tert-butyl N-[(3R,4S)-4-methylpyrrolidin-3-yl]carbamate;hydrochloride (CAS 2173637-27-7) is a chemical compound with the molecular formula C10H21ClN2O2 and a molecular weight of 236.74 g/mol. IUPAC name: tert-butyl N-[(3R,4S)-4-methylpyrrolidin-3-yl]carbamate;hydrochloride. InChIKey: RZXBZGWTVRXEHJ-WSZWBAFRSA-N.
| Molecular formula | C10H21ClN2O2 |
|---|---|
| Molecular weight | 236.74 g/mol |
| IUPAC name | tert-butyl N-[(3R,4S)-4-methylpyrrolidin-3-yl]carbamate;hydrochloride |
| InChIKey | RZXBZGWTVRXEHJ-WSZWBAFRSA-N |
| SMILES | C[C@H]1CNC[C@@H]1NC(=O)OC(C)(C)C.Cl |
Computed by PubChem (NCBI)