tert-Butyl ((3-azabicyclo[3.1.0]hexan-6-yl)methyl)(methyl)carbamate, 95%
cas: 1781667-67-1 — see every product listed under this CAS number, including other names
tert-Butyl ((3-azabicyclo[3.1.0]hexan-6-yl)methyl)(methyl)carbamate, 95% (CAS 1781667-67-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 50mg, 100mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1539329-250mg |
| cas | 1781667-67-1 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 904.38 Pln | |
| Ambeed | 1g | 3396.38 Pln | |
| BLDpharm | 50mg | 358.79 Pln | |
| BLDpharm | 100mg | 564.27 Pln | |
| BLDpharm | 250mg | 969.68 Pln | |
| BLDpharm | 1g | 3657.63 Pln | |
| Chemat | 50mg | 347.60 Pln | |
| Chemat | 100mg | 549.20 Pln | |
| Chemat | 250mg | 928.40 Pln | |
| Chemat | 1g | 3515.60 Pln | |
| Fluorochem | 1g | 6396.72 Pln | |
| Fluorochem | 50mg | 633.13 Pln | |
| Fluorochem | 100mg | 1008.00 Pln | |
| Fluorochem | 250mg | 1710.87 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
Tert-butyl N-(3-azabicyclo[3.1.0]hexan-6-ylmethyl)-N-methylcarbamate (CAS 1781667-67-1) is a chemical compound with the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. IUPAC name: tert-butyl N-(3-azabicyclo[3.1.0]hexan-6-ylmethyl)-N-methylcarbamate. InChIKey: OEFCWJHUGQUXMH-UHFFFAOYSA-N.
| Molecular formula | C12H22N2O2 |
|---|---|
| Molecular weight | 226.32 g/mol |
| IUPAC name | tert-butyl N-(3-azabicyclo[3.1.0]hexan-6-ylmethyl)-N-methylcarbamate |
| InChIKey | OEFCWJHUGQUXMH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(C)CC1C2C1CNC2 |
Computed by PubChem (NCBI)