cas: 1270019-92-5 — see every product listed under this CAS number, including other names
tert-Butyl ((3R,5S)-5-methylpiperidin-3-yl)carbamate 97% (CAS 1270019-92-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A468714-100mg |
| cas | 1270019-92-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 337.00 Pln | |
| Ambeed | 250mg | 392.62 Pln | |
| Ambeed | 1g | 1199.19 Pln | |
| Ambeed | 5g | 3646.69 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A468714 |
Tert-butyl N-[(3R,5S)-5-methylpiperidin-3-yl]carbamate (CAS 1270019-92-5) is a chemical compound with the molecular formula C11H22N2O2 and a molecular weight of 214.30 g/mol. IUPAC name: tert-butyl N-[(3R,5S)-5-methylpiperidin-3-yl]carbamate. InChIKey: CNALVHVMBXLLIY-DTWKUNHWSA-N.
| Molecular formula | C11H22N2O2 |
|---|---|
| Molecular weight | 214.30 g/mol |
| IUPAC name | tert-butyl N-[(3R,5S)-5-methylpiperidin-3-yl]carbamate |
| InChIKey | CNALVHVMBXLLIY-DTWKUNHWSA-N |
| SMILES | C[C@H]1C[C@H](CNC1)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)