cas: 1270019-92-5 — see every product listed under this CAS number, including other names
tert-Butyl ((3R,5S)-5-methylpiperidin-3-yl)carbamate, 97% (CAS 1270019-92-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F609613-100MG |
| cas | 1270019-92-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 388.42 Pln | |
| Fluorochem | 250mg | 513.38 Pln | |
| Fluorochem | 1g | 1596.33 Pln | |
| Fluorochem | 5g | 5922.93 Pln | |
| Fluorochem | 10g | 10223.50 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl N-[(3R,5S)-5-methylpiperidin-3-yl]carbamate (CAS 1270019-92-5) is a chemical compound with the molecular formula C11H22N2O2 and a molecular weight of 214.30 g/mol. IUPAC name: tert-butyl N-[(3R,5S)-5-methylpiperidin-3-yl]carbamate. InChIKey: CNALVHVMBXLLIY-DTWKUNHWSA-N.
| Molecular formula | C11H22N2O2 |
|---|---|
| Molecular weight | 214.30 g/mol |
| IUPAC name | tert-butyl N-[(3R,5S)-5-methylpiperidin-3-yl]carbamate |
| InChIKey | CNALVHVMBXLLIY-DTWKUNHWSA-N |
| SMILES | C[C@H]1C[C@H](CNC1)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)