cas: 67938-77-6 — see every product listed under this CAS number, including other names
tert-Butyl ((5-chloropyridin-2-yl)methyl)carbamate, 95% (CAS 67938-77-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F319013-250MG |
| cas | 67938-77-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 128.10 Pln | |
| Fluorochem | 1g | 341.56 Pln | |
| Fluorochem | 5g | 1476.58 Pln | |
| Fluorochem | 10g | 2903.16 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl N-[(5-chloro-2-pyridinyl)methyl]carbamate (CAS 67938-77-6) is a chemical compound with the molecular formula C11H15ClN2O2 and a molecular weight of 242.70 g/mol. IUPAC name: tert-butyl N-[(5-chloro-2-pyridinyl)methyl]carbamate. InChIKey: IKOORUXAVMEHTF-UHFFFAOYSA-N.
| Molecular formula | C11H15ClN2O2 |
|---|---|
| Molecular weight | 242.70 g/mol |
| IUPAC name | tert-butyl N-[(5-chloro-2-pyridinyl)methyl]carbamate |
| InChIKey | IKOORUXAVMEHTF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1=NC=C(C=C1)Cl |
Computed by PubChem (NCBI)