cas: 1363383-37-2 — see every product listed under this CAS number, including other names
tert-Butyl (2-oxo-1,2-dihydropyridin-4-yl)carbamate 97% (CAS 1363383-37-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A150592-100mg |
| cas | 1363383-37-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 887.69 Pln | |
| Ambeed | 250mg | 1138.00 Pln | |
| Ambeed | 1g | 2556.44 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A150592 |
Tert-butyl N-(2-oxo-1H-pyridin-4-yl)carbamate (CAS 1363383-37-2) is a chemical compound with the molecular formula C10H14N2O3 and a molecular weight of 210.23 g/mol. IUPAC name: tert-butyl N-(2-oxo-1H-pyridin-4-yl)carbamate. InChIKey: VNJZRTVKUGFQOP-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O3 |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | tert-butyl N-(2-oxo-1H-pyridin-4-yl)carbamate |
| InChIKey | VNJZRTVKUGFQOP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC(=O)NC=C1 |
Computed by PubChem (NCBI)