cas: 885270-73-5 — see every product listed under this CAS number, including other names
tert-Butyl (3-amino-4-chlorophenyl)carbamate, ≥97-<99% (CAS 885270-73-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC1938-97-99-1g |
| cas | 885270-73-5 |
| size | 1g |
| availability | 3-4 tygodnie|3-4 weeks |
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 1g | 4142.38 Pln | |
| Hoffman Fine Chemicals | 2,5g | 7300.48 Pln | |
| Hoffman Fine Chemicals | 5g | 11485.76 Pln | |
| Hoffman Fine Chemicals | 10g | 20436.90 Pln | |
| Hoffman Fine Chemicals | 25g | 43079.52 Pln |
| purity | ≥97-<99% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
Tert-butyl N-(3-amino-4-chlorophenyl)carbamate (CAS 885270-73-5) is a chemical compound with the molecular formula C11H15ClN2O2 and a molecular weight of 242.70 g/mol. IUPAC name: tert-butyl N-(3-amino-4-chlorophenyl)carbamate. InChIKey: DBQDDWSYKOTBGD-UHFFFAOYSA-N.
| Molecular formula | C11H15ClN2O2 |
|---|---|
| Molecular weight | 242.70 g/mol |
| IUPAC name | tert-butyl N-(3-amino-4-chlorophenyl)carbamate |
| InChIKey | DBQDDWSYKOTBGD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC(=C(C=C1)Cl)N |
Computed by PubChem (NCBI)