cas: 1086378-71-3 — see every product listed under this CAS number, including other names
tert-Butyl (3-hydroxy-2,3-dihydro-1H-inden-1-yl)carbamate, 95%, 95% (CAS 1086378-71-3) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1106O1-50mg |
| cas | 1086378-71-3 |
| size | 50mg |
| availability | 0.75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 366.80 Pln | |
| Chemat | 100mg | 582.80 Pln | |
| Chemat | 250mg | 842.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-(3-hydroxy-2,3-dihydro-1H-inden-1-yl)carbamate (CAS 1086378-71-3) is a chemical compound with the molecular formula C14H19NO3 and a molecular weight of 249.30 g/mol. IUPAC name: tert-butyl N-(3-hydroxy-2,3-dihydro-1H-inden-1-yl)carbamate. InChIKey: REHNRWSWBXHXSB-UHFFFAOYSA-N.
| Molecular formula | C14H19NO3 |
|---|---|
| Molecular weight | 249.30 g/mol |
| IUPAC name | tert-butyl N-(3-hydroxy-2,3-dihydro-1H-inden-1-yl)carbamate |
| InChIKey | REHNRWSWBXHXSB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1CC(C2=CC=CC=C12)O |
Computed by PubChem (NCBI)