cas: 879324-03-5 — see every product listed under this CAS number, including other names
tert-Butyl (4-oxo-4,5-dihydrothiazol-2-yl)carbamate, 95%, 95% (CAS 879324-03-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IETR-100mg |
| cas | 879324-03-5 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 890.00 Pln | |
| Chemat | 250mg | 1269.20 Pln | |
| Chemat | 1g | 2474.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl (NZ)-N-(4-oxo-1,3-thiazolidin-2-ylidene)carbamate (CAS 879324-03-5) is a chemical compound with the molecular formula C8H12N2O3S and a molecular weight of 216.26 g/mol. IUPAC name: tert-butyl (NZ)-N-(4-oxo-1,3-thiazolidin-2-ylidene)carbamate. InChIKey: VWXXXOWXBIHOHV-UHFFFAOYSA-N.
| Molecular formula | C8H12N2O3S |
|---|---|
| Molecular weight | 216.26 g/mol |
| IUPAC name | tert-butyl (NZ)-N-(4-oxo-1,3-thiazolidin-2-ylidene)carbamate |
| InChIKey | VWXXXOWXBIHOHV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)/N=C\1/NC(=O)CS1 |
Computed by PubChem (NCBI)