cas: 1381958-53-7 — see every product listed under this CAS number, including other names
tert-Butyl (R)-2-(tert-butyl)piperazine-1-carboxylate hydrochloride, 95%, 95% (CAS 1381958-53-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12KKS4-100mg |
| cas | 1381958-53-7 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 405.20 Pln | |
| Chemat | 250mg | 645.20 Pln | |
| Chemat | 1g | 1523.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl (2R)-2-tert-butylpiperazine-1-carboxylate;hydrochloride (CAS 1381958-53-7) is a chemical compound with the molecular formula C13H27ClN2O2 and a molecular weight of 278.82 g/mol. IUPAC name: tert-butyl (2R)-2-tert-butylpiperazine-1-carboxylate;hydrochloride. InChIKey: ADQLANUYQADSBC-PPHPATTJSA-N.
| Molecular formula | C13H27ClN2O2 |
|---|---|
| Molecular weight | 278.82 g/mol |
| IUPAC name | tert-butyl (2R)-2-tert-butylpiperazine-1-carboxylate;hydrochloride |
| InChIKey | ADQLANUYQADSBC-PPHPATTJSA-N |
| SMILES | CC(C)(C)[C@@H]1CNCCN1C(=O)OC(C)(C)C.Cl |
Computed by PubChem (NCBI)