cas: 1251005-45-4 — see every product listed under this CAS number, including other names
tert-Butyl 1,6-diazaspiro[3.5]nonane-1-carboxylate, 97% (CAS 1251005-45-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F230016-100MG |
| cas | 1251005-45-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 732.05 Pln | |
| Fluorochem | 250mg | 1185.02 Pln | |
| Fluorochem | 500mg | 1716.08 Pln | |
| Fluorochem | 1g | 2622.01 Pln | |
| Fluorochem | 5g | 9192.61 Pln | |
| Fluorochem | 10g | 15409.18 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 1,8-diazaspiro[3.5]nonane-1-carboxylate (CAS 1251005-45-4) is a chemical compound with the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. IUPAC name: tert-butyl 1,8-diazaspiro[3.5]nonane-1-carboxylate. InChIKey: CSDLLXOIJNMILT-UHFFFAOYSA-N.
| Molecular formula | C12H22N2O2 |
|---|---|
| Molecular weight | 226.32 g/mol |
| IUPAC name | tert-butyl 1,8-diazaspiro[3.5]nonane-1-carboxylate |
| InChIKey | CSDLLXOIJNMILT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC12CCCNC2 |
Computed by PubChem (NCBI)