cas: 1153767-91-9 — see every product listed under this CAS number, including other names
tert-Butyl 1,8-diazaspiro(4.5)decane-1-carboxylate hydrochloride, 98% (CAS 1153767-91-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A304079-1g |
| cas | 1153767-91-9 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 8871.52 Pln | |
| AmBeed | 10g | 16325.47 Pln | |
| AmBeed | 5g | 10720.36 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
Tert-butyl 1,8-diazaspiro[4.5]decane-1-carboxylate;hydrochloride (CAS 1153767-91-9) is a chemical compound with the molecular formula C13H25ClN2O2 and a molecular weight of 276.80 g/mol. IUPAC name: tert-butyl 1,8-diazaspiro[4.5]decane-1-carboxylate;hydrochloride. InChIKey: RDKNFQFBKPYPKJ-UHFFFAOYSA-N.
| Molecular formula | C13H25ClN2O2 |
|---|---|
| Molecular weight | 276.80 g/mol |
| IUPAC name | tert-butyl 1,8-diazaspiro[4.5]decane-1-carboxylate;hydrochloride |
| InChIKey | RDKNFQFBKPYPKJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC12CCNCC2.Cl |
Computed by PubChem (NCBI)