cas: 1233323-55-1 — see every product listed under this CAS number, including other names
tert-Butyl 1-amino-6-azaspiro[2.5]octane-6-carboxylate, 97%, 97% (CAS 1233323-55-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111KCO-100mg |
| cas | 1233323-55-1 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 664.40 Pln | |
| Chemat | 250mg | 890.00 Pln | |
| Chemat | 500mg | 1187.60 Pln | |
| Chemat | 1g | 1787.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 2-amino-6-azaspiro[2.5]octane-6-carboxylate (CAS 1233323-55-1) is a chemical compound with the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. IUPAC name: tert-butyl 2-amino-6-azaspiro[2.5]octane-6-carboxylate. InChIKey: QZRDFJCRLZNCPN-UHFFFAOYSA-N.
| Molecular formula | C12H22N2O2 |
|---|---|
| Molecular weight | 226.32 g/mol |
| IUPAC name | tert-butyl 2-amino-6-azaspiro[2.5]octane-6-carboxylate |
| InChIKey | QZRDFJCRLZNCPN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)CC2N |
Computed by PubChem (NCBI)