cas: 276872-90-3 — see every product listed under this CAS number, including other names
tert-Butyl 1-oxa-5-azaspiro[2,5]octane-5-carboxylate 98% (CAS 276872-90-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A213266-100mg |
| cas | 276872-90-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 181.25 Pln | |
| Ambeed | 250mg | 270.25 Pln | |
| Ambeed | 1g | 348.12 Pln | |
| Ambeed | 5g | 737.50 Pln | |
| Ambeed | 25g | 3101.56 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A213266 |
Tert-butyl 1-oxa-7-azaspiro[2.5]octane-7-carboxylate (CAS 276872-90-3) is a chemical compound with the molecular formula C11H19NO3 and a molecular weight of 213.27 g/mol. IUPAC name: tert-butyl 1-oxa-7-azaspiro[2.5]octane-7-carboxylate. InChIKey: RZXGVMMKJKHHAN-UHFFFAOYSA-N.
| Molecular formula | C11H19NO3 |
|---|---|
| Molecular weight | 213.27 g/mol |
| IUPAC name | tert-butyl 1-oxa-7-azaspiro[2.5]octane-7-carboxylate |
| InChIKey | RZXGVMMKJKHHAN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC2(C1)CO2 |
Computed by PubChem (NCBI)