CAS 276872-90-3 appears in our catalog under these names: tert-Butyl 1-oxa-5-azaspiro[2,5]octane-5-carboxylate, 95%, tert–Butyl 1–oxa–5–azaspiro(2,5)octane–5–carboxylate, tert-Butyl 1-oxa-5-azaspiro[2,5]octane-5-carboxylate 98%, tert-Butyl 1-oxa-5-azaspiro[2,5]octane-5-carboxylate, 98%, 98%, tert-Butyl 1-oxa-5-azaspiro[2,5]octane-5-carboxylate, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 1g, 10g, 250mg, 100mg.
Tert-butyl 1-oxa-7-azaspiro[2.5]octane-7-carboxylate (CAS 276872-90-3) is a chemical compound with the molecular formula C11H19NO3 and a molecular weight of 213.27 g/mol. IUPAC name: tert-butyl 1-oxa-7-azaspiro[2.5]octane-7-carboxylate. InChIKey: RZXGVMMKJKHHAN-UHFFFAOYSA-N.
| Molecular formula | C11H19NO3 |
|---|---|
| Molecular weight | 213.27 g/mol |
| IUPAC name | tert-butyl 1-oxa-7-azaspiro[2.5]octane-7-carboxylate |
| InChIKey | RZXGVMMKJKHHAN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC2(C1)CO2 |
Computed by PubChem (NCBI)