cas: 276872-90-3 — see every product listed under this CAS number, including other names
tert-Butyl 1-oxa-5-azaspiro[2,5]octane-5-carboxylate, 97% (CAS 276872-90-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F076422-250MG |
| cas | 276872-90-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 169.75 Pln | |
| Fluorochem | 1g | 325.94 Pln | |
| Fluorochem | 5g | 726.85 Pln | |
| Fluorochem | 10g | 1388.07 Pln | |
| Fluorochem | 25g | 3038.53 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 1-oxa-7-azaspiro[2.5]octane-7-carboxylate (CAS 276872-90-3) is a chemical compound with the molecular formula C11H19NO3 and a molecular weight of 213.27 g/mol. IUPAC name: tert-butyl 1-oxa-7-azaspiro[2.5]octane-7-carboxylate. InChIKey: RZXGVMMKJKHHAN-UHFFFAOYSA-N.
| Molecular formula | C11H19NO3 |
|---|---|
| Molecular weight | 213.27 g/mol |
| IUPAC name | tert-butyl 1-oxa-7-azaspiro[2.5]octane-7-carboxylate |
| InChIKey | RZXGVMMKJKHHAN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC2(C1)CO2 |
Computed by PubChem (NCBI)