Products 929302-18-1

CAS 929302-18-1 appears in our catalog under these names: tert-Butyl 2,7-diazaspiro[3.5]nonane-2-carboxylate hydrochloride, 95%, 95%, tert-Butyl 2,7-diazaspiro[3.5]nonane-2-carboxylate (hydrochloride), 98.44%, tert-Butyl 2,7-diazaspiro[3.5]nonane-2-carboxylate hydrochloride, 95%. Offered by: Chemat, MedChemExpress, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 10 g, 250 mg, 5 g.

Structural formula: {0} (CAS {1})

Tert-butyl 2,7-diazaspiro[3.5]nonane-2-carboxylate;hydrochloride (CAS 929302-18-1) is a chemical compound with the molecular formula C12H23ClN2O2 and a molecular weight of 262.77 g/mol. IUPAC name: tert-butyl 2,7-diazaspiro[3.5]nonane-2-carboxylate;hydrochloride. InChIKey: SZACTFROZQQOJB-UHFFFAOYSA-N.

Identity
Molecular formulaC12H23ClN2O2
Molecular weight262.77 g/mol
IUPAC nametert-butyl 2,7-diazaspiro[3.5]nonane-2-carboxylate;hydrochloride
InChIKeySZACTFROZQQOJB-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CC2(C1)CCNCC2.Cl

Computed by PubChem (NCBI)