CAS 1427195-31-0 appears in our catalog under these names: 8-Amino-3-aza-bicyclo[3.2.1]octane-3-carboxylic acid tert-butyl ester hydrochloride, 95%, 8-Amino-3-aza-bicyclo[3.2.1]octane-3-carboxylic acid tert-butyl ester hydrochloride, 97%, 97%, 8-Amino-3-aza-bicyclo[3.2.1]octane-3-carboxylic acid tert-butyl ester hydrochloride, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
Tert-butyl 8-amino-3-azabicyclo[3.2.1]octane-3-carboxylate;hydrochloride (CAS 1427195-31-0) is a chemical compound with the molecular formula C12H23ClN2O2 and a molecular weight of 262.77 g/mol. IUPAC name: tert-butyl 8-amino-3-azabicyclo[3.2.1]octane-3-carboxylate;hydrochloride. InChIKey: RFBKNDDSLDVXMR-UHFFFAOYSA-N.
| Molecular formula | C12H23ClN2O2 |
|---|---|
| Molecular weight | 262.77 g/mol |
| IUPAC name | tert-butyl 8-amino-3-azabicyclo[3.2.1]octane-3-carboxylate;hydrochloride |
| InChIKey | RFBKNDDSLDVXMR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2CCC(C1)C2N.Cl |
Computed by PubChem (NCBI)